C28H22N4O4S — CID 155367877
N-[3-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]phenyl]prop-2-enamide (PubChem CID 155367877) has the molecular formula C28H22N4O4S and a molecular weight of 510.58 g/mol. Its IUPAC name is N-[3-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155367877 |
| Molecular Formula | C28H22N4O4S |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | N-[3-[9-[4-(methanesulfonamido)phenyl]-2-oxobenzo[h][1,6]naphthyridin-1-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-n2c(=O)ccc3cnc4ccc(-c5ccc(NS(C)(=O)=O)cc5)cc4c32)c1 |
| InChI | InChI=1S/C28H22N4O4S/c1-3-26(33)30-22-5-4-6-23(16-22)32-27(34)14-10-20-17-29-25-13-9-19(15-24(25)28(20)32)18-7-11-21(12-8-18)31-37(2,35)36/h3-17,31H,1H2,2H3,(H,30,33) |
| InChIKey | BBPCMUWBZJCOKJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|