C26H20N4O5S — CID 129011312
N-[4-[1-(4-methyl-3-nitrophenyl)-2-oxobenzo[h][1,6]naphthyridin-9-yl]phenyl]methanesulfonamide (PubChem CID 129011312) has the molecular formula C26H20N4O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is N-[4-[1-(4-methyl-3-nitrophenyl)-2-oxobenzo[h][1,6]naphthyridin-9-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[1-(4-methyl-3-nitrophenyl)-2-oxobenzo[h][1,6]naphthyridin-9-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 129011312 |
| Molecular Formula | C26H20N4O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | N-[4-[1-(4-methyl-3-nitrophenyl)-2-oxobenzo[h][1,6]naphthyridin-9-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(-n2c(=O)ccc3cnc4ccc(-c5ccc(NS(C)(=O)=O)cc5)cc4c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20N4O5S/c1-16-3-10-21(14-24(16)30(32)33)29-25(31)12-7-19-15-27-23-11-6-18(13-22(23)26(19)29)17-4-8-20(9-5-17)28-36(2,34)35/h3-15,28H,1-2H3 |
| InChIKey | PUWJBNVCXXCOKJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 124.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|