C19H13FN2O — CID 118148099
1-(4-fluorophenyl)-9-methylbenzo[h][1,6]naphthyridin-2-one (PubChem CID 118148099) has the molecular formula C19H13FN2O and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-9-methylbenzo[h][1,6]naphthyridin-2-one.
| Compound Name | 1-(4-fluorophenyl)-9-methylbenzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 118148099 |
| Molecular Formula | C19H13FN2O |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-(4-fluorophenyl)-9-methylbenzo[h][1,6]naphthyridin-2-one |
| SMILES | Cc1ccc2ncc3ccc(=O)n(-c4ccc(F)cc4)c3c2c1 |
| InChI | InChI=1S/C19H13FN2O/c1-12-2-8-17-16(10-12)19-13(11-21-17)3-9-18(23)22(19)15-6-4-14(20)5-7-15/h2-11H,1H3 |
| InChIKey | MUTZSEIXCCIEAA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|