C24H19N3O2 — CID 118148085
9-methyl-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one (PubChem CID 118148085) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 9-methyl-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-methyl-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 118148085 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 9-methyl-1-(1-prop-2-enoyl-2,3-dihydroindol-6-yl)benzo[h][1,6]naphthyridin-2-one |
| SMILES | C=CC(=O)N1CCc2ccc(-n3c(=O)ccc4cnc5ccc(C)cc5c43)cc21 |
| InChI | InChI=1S/C24H19N3O2/c1-3-22(28)26-11-10-16-5-7-18(13-21(16)26)27-23(29)9-6-17-14-25-20-8-4-15(2)12-19(20)24(17)27/h3-9,12-14H,1,10-11H2,2H3 |
| InChIKey | QFPXNQLUNBGUOH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|