C32H33N3O2 — CID 160722009
ethane;N-methyl-N-[3-(2-oxo-9-phenylbenzo[h][1,6]naphthyridin-1-yl)phenyl]prop-2-enamide (PubChem CID 160722009) has the molecular formula C32H33N3O2 and a molecular weight of 491.64 g/mol. Its IUPAC name is ethane;N-methyl-N-[3-(2-oxo-9-phenylbenzo[h][1,6]naphthyridin-1-yl)phenyl]prop-2-enamide.
| Compound Name | ethane;N-methyl-N-[3-(2-oxo-9-phenylbenzo[h][1,6]naphthyridin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 160722009 |
| Molecular Formula | C32H33N3O2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | ethane;N-methyl-N-[3-(2-oxo-9-phenylbenzo[h][1,6]naphthyridin-1-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)c1cccc(-n2c(=O)ccc3cnc4ccc(-c5ccccc5)cc4c32)c1.CC.CC |
| InChI | InChI=1S/C28H21N3O2.2C2H6/c1-3-26(32)30(2)22-10-7-11-23(17-22)31-27(33)15-13-21-18-29-25-14-12-20(16-24(25)28(21)31)19-8-5-4-6-9-19;2*1-2/h3-18H,1H2,2H3;2*1-2H3 |
| InChIKey | RTFMJYZMQURAPY-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|