C28H20F3N3O — CID 58525099
9-(3-methyl-3a,7a-dihydro-1H-isoindol-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 58525099) has the molecular formula C28H20F3N3O and a molecular weight of 471.48 g/mol. Its IUPAC name is 9-(3-methyl-3a,7a-dihydro-1H-isoindol-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(3-methyl-3a,7a-dihydro-1H-isoindol-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 58525099 |
| Molecular Formula | C28H20F3N3O |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 9-(3-methyl-3a,7a-dihydro-1H-isoindol-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | CC1=NCC2C=CC(c3ccc4ncc5ccc(=O)n(-c6cccc(C(F)(F)F)c6)c5c4c3)=CC12 |
| InChI | InChI=1S/C28H20F3N3O/c1-16-23-11-17(5-6-19(23)14-32-16)18-7-9-25-24(12-18)27-20(15-33-25)8-10-26(35)34(27)22-4-2-3-21(13-22)28(29,30)31/h2-13,15,19,23H,14H2,1H3 |
| InChIKey | YCMUFTHEYUNTRA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|