C24H16F3N5O — CID 135267110
2-[6-(methylamino)-3-pyridinyl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 135267110) has the molecular formula C24H16F3N5O and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-[6-(methylamino)-3-pyridinyl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-[6-(methylamino)-3-pyridinyl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 135267110 |
| Molecular Formula | C24H16F3N5O |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[6-(methylamino)-3-pyridinyl]-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | CNc1ccc(-c2ccc3ncc4ccc(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C24H16F3N5O/c1-28-20-9-5-14(12-30-20)18-7-8-19-22(31-18)23-15(13-29-19)6-10-21(33)32(23)17-4-2-3-16(11-17)24(25,26)27/h2-13H,1H3,(H,28,30) |
| InChIKey | DEZDJJLWCCDWOF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|