C26H15F6N3O — CID 155249694
9-[4-(trifluoromethyl)anilino]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 155249694) has the molecular formula C26H15F6N3O and a molecular weight of 499.41 g/mol. Its IUPAC name is 9-[4-(trifluoromethyl)anilino]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-[4-(trifluoromethyl)anilino]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 155249694 |
| Molecular Formula | C26H15F6N3O |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 9-[4-(trifluoromethyl)anilino]-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | O=c1ccc2cnc3ccc(Nc4ccc(C(F)(F)F)cc4)cc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H15F6N3O/c27-25(28,29)16-5-7-18(8-6-16)34-19-9-10-22-21(13-19)24-15(14-33-22)4-11-23(36)35(24)20-3-1-2-17(12-20)26(30,31)32/h1-14,34H |
| InChIKey | MBJHRVFBSWUSJQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|