C21H11F3N4OS — CID 71112670
2-(1,3-thiazol-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 71112670) has the molecular formula C21H11F3N4OS and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-(1,3-thiazol-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 71112670 |
| Molecular Formula | C21H11F3N4OS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-(1,3-thiazol-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | O=c1ccc2cnc3ccc(-c4cncs4)nc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H11F3N4OS/c22-21(23,24)13-2-1-3-14(8-13)28-18(29)7-4-12-9-26-16-6-5-15(17-10-25-11-30-17)27-19(16)20(12)28/h1-11H |
| InChIKey | KCJYVFFVGYOKAL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|