C23H16F3N6O6P — CID 78425905
[9-(6-amino-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 78425905) has the molecular formula C23H16F3N6O6P and a molecular weight of 560.39 g/mol. Its IUPAC name is [9-(6-amino-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [9-(6-amino-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 78425905 |
| Molecular Formula | C23H16F3N6O6P |
| Molecular Weight | 560.39 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | [9-(6-amino-3-pyridinyl)-2,4-dioxo-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | Nc1ccc(-c2ccc3ncc4c(=O)n(COP(=O)(O)O)c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C23H16F3N6O6P/c24-23(25,26)13-2-1-3-14(8-13)32-20-15(21(33)31(22(32)34)11-38-39(35,36)37)10-28-17-6-5-16(30-19(17)20)12-4-7-18(27)29-9-12/h1-10H,11H2,(H2,27,29)(H2,35,36,37) |
| InChIKey | OXXUDQCDGKRLCE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 175.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|