C30H28N7O7P — CID 86303583
[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-morpholin-4-yl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 86303583) has the molecular formula C30H28N7O7P and a molecular weight of 629.57 g/mol. Its IUPAC name is [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-morpholin-4-yl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-morpholin-4-yl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 86303583 |
| Molecular Formula | C30H28N7O7P |
| Molecular Weight | 629.57 g/mol |
| Exact Mass | 629.18 |
| IUPAC Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(6-morpholin-4-yl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)(C#N)c1ccc(-n2c(=O)n(COP(=O)(O)O)c(=O)c3cnc4ccc(-c5ccc(N6CCOCC6)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C30H28N7O7P/c1-30(2,17-31)20-4-6-21(7-5-20)37-27-22(28(38)36(29(37)39)18-44-45(40,41)42)16-32-24-9-8-23(34-26(24)27)19-3-10-25(33-15-19)35-11-13-43-14-12-35/h3-10,15-16H,11-14,18H2,1-2H3,(H2,40,41,42) |
| InChIKey | HZYBVKPBCFTPNP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 185.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|