C25H22N7O6P — CID 86304195
[1-[4-(2-cyanopropan-2-yl)phenyl]-9-(1-methylpyrazol-4-yl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate (PubChem CID 86304195) has the molecular formula C25H22N7O6P and a molecular weight of 547.47 g/mol. Its IUPAC name is [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(1-methylpyrazol-4-yl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate.
| Compound Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(1-methylpyrazol-4-yl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 86304195 |
| Molecular Formula | C25H22N7O6P |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | [1-[4-(2-cyanopropan-2-yl)phenyl]-9-(1-methylpyrazol-4-yl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-3-yl]methyl dihydrogen phosphate |
| SMILES | Cn1cc(-c2ccc3ncc4c(=O)n(COP(=O)(O)O)c(=O)n(-c5ccc(C(C)(C)C#N)cc5)c4c3n2)cn1 |
| InChI | InChI=1S/C25H22N7O6P/c1-25(2,13-26)16-4-6-17(7-5-16)32-22-18(23(33)31(24(32)34)14-38-39(35,36)37)11-27-20-9-8-19(29-21(20)22)15-10-28-30(3)12-15/h4-12H,14H2,1-3H3,(H2,35,36,37) |
| InChIKey | FCMMEKMKJBDLGS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 178.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|