C28H25N9O2 — CID 129089263
2-[4-[2,4-dioxo-9-(2-piperazin-1-ylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile (PubChem CID 129089263) has the molecular formula C28H25N9O2 and a molecular weight of 519.57 g/mol. Its IUPAC name is 2-[4-[2,4-dioxo-9-(2-piperazin-1-ylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[2,4-dioxo-9-(2-piperazin-1-ylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 129089263 |
| Molecular Formula | C28H25N9O2 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[4-[2,4-dioxo-9-(2-piperazin-1-ylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(-n2c(=O)[nH]c(=O)c3cnc4ccc(-c5cnc(N6CCNCC6)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C28H25N9O2/c1-28(2,16-29)18-3-5-19(6-4-18)37-24-20(25(38)35-27(37)39)15-31-22-8-7-21(34-23(22)24)17-13-32-26(33-14-17)36-11-9-30-10-12-36/h3-8,13-15,30H,9-12H2,1-2H3,(H,35,38,39) |
| InChIKey | OJHPCOWVFFYYKP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 145.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|