C26H23N5O3 — CID 163526904
1-(4-tert-butylphenyl)-9-[6-(hydroxymethyl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 163526904) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-9-[6-(hydroxymethyl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-(4-tert-butylphenyl)-9-[6-(hydroxymethyl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 163526904 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-9-[6-(hydroxymethyl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(-n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(CO)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C26H23N5O3/c1-26(2,3)16-5-8-18(9-6-16)31-23-19(24(33)30-25(31)34)13-28-21-11-10-20(29-22(21)23)15-4-7-17(14-32)27-12-15/h4-13,32H,14H2,1-3H3,(H,30,33,34) |
| InChIKey | DPOHHFSJDZVFSA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|