C24H24N6O5 — CID 90077663
9-[6-(hydroxymethyl)-3-pyridinyl]-1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077663) has the molecular formula C24H24N6O5 and a molecular weight of 476.49 g/mol. Its IUPAC name is 9-[6-(hydroxymethyl)-3-pyridinyl]-1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077663 |
| Molecular Formula | C24H24N6O5 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 9-[6-(hydroxymethyl)-3-pyridinyl]-1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | C[C@@H](O)C(=O)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(CO)nc5)nc4c32)CC1 |
| InChI | InChI=1S/C24H24N6O5/c1-13(32)23(34)29-8-6-16(7-9-29)30-21-17(22(33)28-24(30)35)11-26-19-5-4-18(27-20(19)21)14-2-3-15(12-31)25-10-14/h2-5,10-11,13,16,31-32H,6-9,12H2,1H3,(H,28,33,35)/t13-/m1/s1 |
| InChIKey | JDWHBRJLJHREFS-CYBMUJFWSA-N |
| XLogP | 0.73 |
| TPSA | 154.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|