C21H21N7O4 — CID 118329029
1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-(1H-pyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 118329029) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-(1H-pyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-(1H-pyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 118329029 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-(1H-pyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COCC(=O)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5cn[nH]c5)nc4c32)CC1 |
| InChI | InChI=1S/C21H21N7O4/c1-32-11-17(29)27-6-4-13(5-7-27)28-19-14(20(30)26-21(28)31)10-22-16-3-2-15(25-18(16)19)12-8-23-24-9-12/h2-3,8-10,13H,4-7,11H2,1H3,(H,23,24)(H,26,30,31) |
| InChIKey | GEYWAGFEUURVAX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|