C28H32N8O4 — CID 90077674
1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077674) has the molecular formula C28H32N8O4 and a molecular weight of 544.62 g/mol. Its IUPAC name is 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077674 |
| Molecular Formula | C28H32N8O4 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 1-[1-(2-methoxyacetyl)piperidin-4-yl]-9-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COCC(=O)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(N6CCN(C)CC6)nc5)nc4c32)CC1 |
| InChI | InChI=1S/C28H32N8O4/c1-33-11-13-34(14-12-33)23-6-3-18(15-30-23)21-4-5-22-25(31-21)26-20(16-29-22)27(38)32-28(39)36(26)19-7-9-35(10-8-19)24(37)17-40-2/h3-6,15-16,19H,7-14,17H2,1-2H3,(H,32,38,39) |
| InChIKey | OCGJTAWTTZJSLF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|