C24H25N7O3 — CID 129089229
1-(1-but-1-en-2-ylpiperidin-4-yl)-9-(2-methoxypyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 129089229) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 1-(1-but-1-en-2-ylpiperidin-4-yl)-9-(2-methoxypyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-(1-but-1-en-2-ylpiperidin-4-yl)-9-(2-methoxypyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 129089229 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-(1-but-1-en-2-ylpiperidin-4-yl)-9-(2-methoxypyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | C=C(CC)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5cnc(OC)nc5)nc4c32)CC1 |
| InChI | InChI=1S/C24H25N7O3/c1-4-14(2)30-9-7-16(8-10-30)31-21-17(22(32)29-24(31)33)13-25-19-6-5-18(28-20(19)21)15-11-26-23(34-3)27-12-15/h5-6,11-13,16H,2,4,7-10H2,1,3H3,(H,29,32,33) |
| InChIKey | ORAHCMNBNBOEFD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|