C23H25N9O2 — CID 129089218
9-(2-aminopyrimidin-5-yl)-1-[1-(2-methylpropanimidoyl)piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 129089218) has the molecular formula C23H25N9O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 9-(2-aminopyrimidin-5-yl)-1-[1-(2-methylpropanimidoyl)piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(2-aminopyrimidin-5-yl)-1-[1-(2-methylpropanimidoyl)piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 129089218 |
| Molecular Formula | C23H25N9O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 9-(2-aminopyrimidin-5-yl)-1-[1-(2-methylpropanimidoyl)piperidin-4-yl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | [H]/N=C(\C(C)C)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5cnc(N)nc5)nc4c32)CC1 |
| InChI | InChI=1S/C23H25N9O2/c1-12(2)20(24)31-7-5-14(6-8-31)32-19-15(21(33)30-23(32)34)11-26-17-4-3-16(29-18(17)19)13-9-27-22(25)28-10-13/h3-4,9-12,14,24H,5-8H2,1-2H3,(H2,25,27,28)(H,30,33,34)/b24-20+ |
| InChIKey | FVRJHSHZVCNZNQ-HIXSDJFHSA-N |
| XLogP | 1.94 |
| TPSA | 159.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|