C22H20N6O4S — CID 90077671
1-[1-[(2R)-2-nitrosopropanoyl]piperidin-4-yl]-9-thiophen-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077671) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is 1-[1-[(2R)-2-nitrosopropanoyl]piperidin-4-yl]-9-thiophen-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[1-[(2R)-2-nitrosopropanoyl]piperidin-4-yl]-9-thiophen-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077671 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1-[1-[(2R)-2-nitrosopropanoyl]piperidin-4-yl]-9-thiophen-3-ylpyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | C[C@@H](N=O)C(=O)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccsc5)nc4c32)CC1 |
| InChI | InChI=1S/C22H20N6O4S/c1-12(26-32)21(30)27-7-4-14(5-8-27)28-19-15(20(29)25-22(28)31)10-23-17-3-2-16(24-18(17)19)13-6-9-33-11-13/h2-3,6,9-12,14H,4-5,7-8H2,1H3,(H,25,29,31)/t12-/m1/s1 |
| InChIKey | KQXLHWPDGFDZKX-GFCCVEGCSA-N |
| XLogP | 2.68 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|