C27H24N6O3 — CID 129088403
N-[5-[1-(4-tert-butylphenyl)-2,4-dioxopyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide (PubChem CID 129088403) has the molecular formula C27H24N6O3 and a molecular weight of 480.53 g/mol. Its IUPAC name is N-[5-[1-(4-tert-butylphenyl)-2,4-dioxopyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[1-(4-tert-butylphenyl)-2,4-dioxopyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 129088403 |
| Molecular Formula | C27H24N6O3 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-[5-[1-(4-tert-butylphenyl)-2,4-dioxopyrimido[5,4-h][1,5]naphthyridin-9-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc3ncc4c(=O)[nH]c(=O)n(-c5ccc(C(C)(C)C)cc5)c4c3n2)cn1 |
| InChI | InChI=1S/C27H24N6O3/c1-15(34)30-22-12-5-16(13-29-22)20-10-11-21-23(31-20)24-19(14-28-21)25(35)32-26(36)33(24)18-8-6-17(7-9-18)27(2,3)4/h5-14H,1-4H3,(H,29,30,34)(H,32,35,36) |
| InChIKey | HMYYNZBCWYQHML-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|