C22H13F3N6O — CID 71112303
2-(2-aminopyrimidin-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one (PubChem CID 71112303) has the molecular formula C22H13F3N6O and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-(2-aminopyrimidin-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one.
| Compound Name | 2-(2-aminopyrimidin-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
|---|---|
| PubChem CID | 71112303 |
| Molecular Formula | C22H13F3N6O |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-(2-aminopyrimidin-5-yl)-10-[3-(trifluoromethyl)phenyl]pyrido[3,2-c][1,5]naphthyridin-9-one |
| SMILES | Nc1ncc(-c2ccc3ncc4ccc(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C22H13F3N6O/c23-22(24,25)14-2-1-3-15(8-14)31-18(32)7-4-12-9-27-17-6-5-16(30-19(17)20(12)31)13-10-28-21(26)29-11-13/h1-11H,(H2,26,28,29) |
| InChIKey | YLQPULWHRZZBIB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|