C28H17F3N2O2 — CID 164965689
9-(2-oxo-1,3-dihydroinden-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 164965689) has the molecular formula C28H17F3N2O2 and a molecular weight of 470.45 g/mol. Its IUPAC name is 9-(2-oxo-1,3-dihydroinden-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(2-oxo-1,3-dihydroinden-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 164965689 |
| Molecular Formula | C28H17F3N2O2 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 9-(2-oxo-1,3-dihydroinden-5-yl)-1-[3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | O=C1Cc2ccc(-c3ccc4ncc5ccc(=O)n(-c6cccc(C(F)(F)F)c6)c5c4c3)cc2C1 |
| InChI | InChI=1S/C28H17F3N2O2/c29-28(30,31)21-2-1-3-22(14-21)33-26(35)9-7-19-15-32-25-8-6-18(13-24(25)27(19)33)16-4-5-17-11-23(34)12-20(17)10-16/h1-10,13-15H,11-12H2 |
| InChIKey | CLIFUEKAJVPUQV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|