C23H14F3N3O — CID 127047610
8-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one (PubChem CID 127047610) has the molecular formula C23H14F3N3O and a molecular weight of 405.38 g/mol. Its IUPAC name is 8-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 127047610 |
| Molecular Formula | C23H14F3N3O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 8-phenyl-1-[3-(trifluoromethyl)phenyl]-3H-imidazo[4,5-c]quinolin-2-one |
| SMILES | O=c1[nH]c2cnc3ccc(-c4ccccc4)cc3c2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H14F3N3O/c24-23(25,26)16-7-4-8-17(12-16)29-21-18-11-15(14-5-2-1-3-6-14)9-10-19(18)27-13-20(21)28-22(29)30/h1-13H,(H,28,30) |
| InChIKey | JODLAQDKCGLISF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |