C14H8F3N3O2 — CID 13282380
1-[3-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidine-2,4-dione (PubChem CID 13282380) has the molecular formula C14H8F3N3O2 and a molecular weight of 307.23 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 13282380 |
| Molecular Formula | C14H8F3N3O2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]pyrido[4,3-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(C(F)(F)F)c2)c2ccncc12 |
| InChI | InChI=1S/C14H8F3N3O2/c15-14(16,17)8-2-1-3-9(6-8)20-11-4-5-18-7-10(11)12(21)19-13(20)22/h1-7H,(H,19,21,22) |
| InChIKey | SCOSTOLGOWOSIM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |