C15H11F3N2O2 — CID 117207571
3-(3-methoxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 117207571) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one.
| Compound Name | 3-(3-methoxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117207571 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-(3-methoxyphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | COc1cccc(-n2c(=O)[nH]c3cc(C(F)(F)F)ccc32)c1 |
| InChI | InChI=1S/C15H11F3N2O2/c1-22-11-4-2-3-10(8-11)20-13-6-5-9(15(16,17)18)7-12(13)19-14(20)21/h2-8H,1H3,(H,19,21) |
| InChIKey | UUORJKBMSWGHJH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |