C20H13F3N2O3 — CID 69441713
3-(2,4-dihydroxy-5-phenylphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 69441713) has the molecular formula C20H13F3N2O3 and a molecular weight of 386.33 g/mol. Its IUPAC name is 3-(2,4-dihydroxy-5-phenylphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one.
| Compound Name | 3-(2,4-dihydroxy-5-phenylphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 69441713 |
| Molecular Formula | C20H13F3N2O3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-(2,4-dihydroxy-5-phenylphenyl)-6-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(C(F)(F)F)ccc2n1-c1cc(-c2ccccc2)c(O)cc1O |
| InChI | InChI=1S/C20H13F3N2O3/c21-20(22,23)12-6-7-15-14(8-12)24-19(28)25(15)16-9-13(17(26)10-18(16)27)11-4-2-1-3-5-11/h1-10,26-27H,(H,24,28) |
| InChIKey | FUKJFWXYWRZSNF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |