C14H9N3O3 — CID 69445541
2,4-dihydroxy-5-(2-oxo-3H-benzimidazol-1-yl)benzonitrile (PubChem CID 69445541) has the molecular formula C14H9N3O3 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2,4-dihydroxy-5-(2-oxo-3H-benzimidazol-1-yl)benzonitrile.
| Compound Name | 2,4-dihydroxy-5-(2-oxo-3H-benzimidazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 69445541 |
| Molecular Formula | C14H9N3O3 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2,4-dihydroxy-5-(2-oxo-3H-benzimidazol-1-yl)benzonitrile |
| SMILES | N#Cc1cc(-n2c(=O)[nH]c3ccccc32)c(O)cc1O |
| InChI | InChI=1S/C14H9N3O3/c15-7-8-5-11(13(19)6-12(8)18)17-10-4-2-1-3-9(10)16-14(17)20/h1-6,18-19H,(H,16,20) |
| InChIKey | VBVVNEBVNOLIJG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |