About 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one
3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one (PubChem CID 69444922) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one |
| PubChem CID | 69444922 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one |
| SMILES | CC(C)(C)C=Cc1cc(-n2c(=O)[nH]c3ccccc32)c(O)cc1O |
| InChI | InChI=1S/C19H20N2O3/c1-19(2,3)9-8-12-10-15(17(23)11-16(12)22)21-14-7-5-4-6-13(14)20-18(21)24/h4-11,22-23H,1-3H3,(H,20,24) |
| InChIKey | FXNIVSASKLINJT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one?
The IUPAC name of 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one (CID 69444922) is 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one.
What is the SMILES notation for 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one?
The canonical SMILES for 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one is CC(C)(C)C=Cc1cc(-n2c(=O)[nH]c3ccccc32)c(O)cc1O.
What is the InChIKey of 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one?
The InChIKey is FXNIVSASKLINJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-19(2,3)9-8-12-10-15(17(23)11-16(12)22)21-14-7-5-4-6-13(14)20-18(21)24/h4-11,22-23H,1-3H3,(H,20,24).
What are the key properties of 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one?
3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one has a molecular weight of 324.38 g/mol, XLogP of 3.79, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3,3-dimethylbut-1-enyl)-2,4-dihydroxyphenyl]-1H-benzimidazol-2-one is sourced from PubChem (CID 69444922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).