C22H17F3N2O — CID 134084698
3-(2-phenylethyl)-6-[3-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one (PubChem CID 134084698) has the molecular formula C22H17F3N2O and a molecular weight of 382.39 g/mol. Its IUPAC name is 3-(2-phenylethyl)-6-[3-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one.
| Compound Name | 3-(2-phenylethyl)-6-[3-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 134084698 |
| Molecular Formula | C22H17F3N2O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-(2-phenylethyl)-6-[3-(trifluoromethyl)phenyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2cc(-c3cccc(C(F)(F)F)c3)ccc2n1CCc1ccccc1 |
| InChI | InChI=1S/C22H17F3N2O/c23-22(24,25)18-8-4-7-16(13-18)17-9-10-20-19(14-17)26-21(28)27(20)12-11-15-5-2-1-3-6-15/h1-10,13-14H,11-12H2,(H,26,28) |
| InChIKey | VIBOXHWEMUHIFA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |