C15H15N3O — CID 110491478
6-amino-3-(2-phenylethyl)-1H-benzimidazol-2-one (PubChem CID 110491478) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 6-amino-3-(2-phenylethyl)-1H-benzimidazol-2-one.
| Compound Name | 6-amino-3-(2-phenylethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 110491478 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-amino-3-(2-phenylethyl)-1H-benzimidazol-2-one |
| SMILES | Nc1ccc2c(c1)[nH]c(=O)n2CCc1ccccc1 |
| InChI | InChI=1S/C15H15N3O/c16-12-6-7-14-13(10-12)17-15(19)18(14)9-8-11-4-2-1-3-5-11/h1-7,10H,8-9,16H2,(H,17,19) |
| InChIKey | GIJAJNAUGQQDPE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|