C24H29F3N4O — CID 23369442
3-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1H-benzimidazol-2-one (PubChem CID 23369442) has the molecular formula C24H29F3N4O and a molecular weight of 446.52 g/mol. Its IUPAC name is 3-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 23369442 |
| Molecular Formula | C24H29F3N4O |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 3-[6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CCCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H29F3N4O/c25-24(26,27)19-8-7-9-20(18-19)30-16-14-29(15-17-30)12-5-1-2-6-13-31-22-11-4-3-10-21(22)28-23(31)32/h3-4,7-11,18H,1-2,5-6,12-17H2,(H,28,32) |
| InChIKey | RIJHWWJHRCVHQZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|