C25H31F3N4O2 — CID 10277233
1-(2-methoxyethyl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-2-one (PubChem CID 10277233) has the molecular formula C25H31F3N4O2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-2-one.
| Compound Name | 1-(2-methoxyethyl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 10277233 |
| Molecular Formula | C25H31F3N4O2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-2-one |
| SMILES | COCCn1c(=O)n(CCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H31F3N4O2/c1-34-18-17-32-23-10-3-2-9-22(23)31(24(32)33)12-5-4-11-29-13-15-30(16-14-29)21-8-6-7-20(19-21)25(26,27)28/h2-3,6-10,19H,4-5,11-18H2,1H3 |
| InChIKey | JAJXLYTXFRFXIJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|