C27H34F3N5O3 — CID 18630877
2-[2-oxo-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-1-yl]ethyl N-ethylcarbamate (PubChem CID 18630877) has the molecular formula C27H34F3N5O3 and a molecular weight of 533.60 g/mol. Its IUPAC name is 2-[2-oxo-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-1-yl]ethyl N-ethylcarbamate.
| Compound Name | 2-[2-oxo-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-1-yl]ethyl N-ethylcarbamate |
|---|---|
| PubChem CID | 18630877 |
| Molecular Formula | C27H34F3N5O3 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 2-[2-oxo-3-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]benzimidazol-1-yl]ethyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCn1c(=O)n(CCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H34F3N5O3/c1-2-31-25(36)38-19-18-35-24-11-4-3-10-23(24)34(26(35)37)13-6-5-12-32-14-16-33(17-15-32)22-9-7-8-21(20-22)27(28,29)30/h3-4,7-11,20H,2,5-6,12-19H2,1H3,(H,31,36) |
| InChIKey | SLDYOSWWEUYPSB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|