C16H24F3N5 — CID 110930670
2-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine (PubChem CID 110930670) has the molecular formula C16H24F3N5 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine.
| Compound Name | 2-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 110930670 |
| Molecular Formula | C16H24F3N5 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-methyl-1-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]guanidine |
| SMILES | C/N=C(\N)NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H24F3N5/c1-21-15(20)22-6-3-7-23-8-10-24(11-9-23)14-5-2-4-13(12-14)16(17,18)19/h2,4-5,12H,3,6-11H2,1H3,(H3,20,21,22) |
| InChIKey | KZEWDZKCKZRKBC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|