C17H25F3N2 — CID 3317565
1-hexyl-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 3317565) has the molecular formula C17H25F3N2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 1-hexyl-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-hexyl-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 3317565 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-hexyl-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CCCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H25F3N2/c1-2-3-4-5-9-21-10-12-22(13-11-21)16-8-6-7-15(14-16)17(18,19)20/h6-8,14H,2-5,9-13H2,1H3 |
| InChIKey | XFJMYVIQQRIHKS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|