C21H33F3N2O2 — CID 110181730
1-heptoxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol (PubChem CID 110181730) has the molecular formula C21H33F3N2O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-heptoxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol.
| Compound Name | 1-heptoxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 110181730 |
| Molecular Formula | C21H33F3N2O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | 1-heptoxy-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-2-ol |
| SMILES | CCCCCCCOCC(O)CN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H33F3N2O2/c1-2-3-4-5-6-14-28-17-20(27)16-25-10-12-26(13-11-25)19-9-7-8-18(15-19)21(22,23)24/h7-9,15,20,27H,2-6,10-14,16-17H2,1H3 |
| InChIKey | LZJKDIFNLAMGOF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|