C25H30F3N3O — CID 11532392
1-(1,3-dihydroisoindol-2-yl)-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one (PubChem CID 11532392) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 11532392 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]hexan-1-one |
| SMILES | O=C(CCCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C25H30F3N3O/c26-25(27,28)22-9-6-10-23(17-22)30-15-13-29(14-16-30)12-5-1-2-11-24(32)31-18-20-7-3-4-8-21(20)19-31/h3-4,6-10,17H,1-2,5,11-16,18-19H2 |
| InChIKey | SGAWHIAPSQNPJG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|