C24H32F3N3O — CID 143172204
5-[1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrol-2-yl]pentan-2-one (PubChem CID 143172204) has the molecular formula C24H32F3N3O and a molecular weight of 435.53 g/mol. Its IUPAC name is 5-[1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrol-2-yl]pentan-2-one.
| Compound Name | 5-[1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrol-2-yl]pentan-2-one |
|---|---|
| PubChem CID | 143172204 |
| Molecular Formula | C24H32F3N3O |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 5-[1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrol-2-yl]pentan-2-one |
| SMILES | CC(=O)CCCc1cccn1CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H32F3N3O/c1-20(31)7-4-9-22-11-6-14-29(22)13-3-2-12-28-15-17-30(18-16-28)23-10-5-8-21(19-23)24(25,26)27/h5-6,8,10-11,14,19H,2-4,7,9,12-13,15-18H2,1H3 |
| InChIKey | FUJTWJCHJQTPLT-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|