C21H29F3N2O — CID 157343351
1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]ethanone (PubChem CID 157343351) has the molecular formula C21H29F3N2O and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]ethanone.
| Compound Name | 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 157343351 |
| Molecular Formula | C21H29F3N2O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]ethanone |
| SMILES | CC(=O)C1CCC(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H29F3N2O/c1-16(27)18-7-5-17(6-8-18)9-10-25-11-13-26(14-12-25)20-4-2-3-19(15-20)21(22,23)24/h2-4,15,17-18H,5-14H2,1H3 |
| InChIKey | BGQWAKOODDNAIC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |