C22H29F3N2O — CID 90968924
1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexen-1-yl]propan-2-one (PubChem CID 90968924) has the molecular formula C22H29F3N2O and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexen-1-yl]propan-2-one.
| Compound Name | 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexen-1-yl]propan-2-one |
|---|---|
| PubChem CID | 90968924 |
| Molecular Formula | C22H29F3N2O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 1-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexen-1-yl]propan-2-one |
| SMILES | CC(=O)CC1=CCC(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H29F3N2O/c1-17(28)15-19-7-5-18(6-8-19)9-10-26-11-13-27(14-12-26)21-4-2-3-20(16-21)22(23,24)25/h2-4,7,16,18H,5-6,8-15H2,1H3 |
| InChIKey | ANYIDKMBUKOKFK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|