C23H33F3N6O2 — CID 118486309
N'-hydrazinylidene-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanediamide (PubChem CID 118486309) has the molecular formula C23H33F3N6O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is N'-hydrazinylidene-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanediamide.
| Compound Name | N'-hydrazinylidene-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanediamide |
|---|---|
| PubChem CID | 118486309 |
| Molecular Formula | C23H33F3N6O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N'-hydrazinylidene-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanediamide |
| SMILES | N/N=N/C(=O)CCC(=O)NC1CCC(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H33F3N6O2/c24-23(25,26)18-2-1-3-20(16-18)32-14-12-31(13-15-32)11-10-17-4-6-19(7-5-17)28-21(33)8-9-22(34)29-30-27/h1-3,16-17,19H,4-15H2,(H,28,33)(H2,27,29,34) |
| InChIKey | XLNZCENTQDXTTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|