C25H40N4O2 — CID 70956348
4-amino-N-[4-[2-[4-(3-propanoylphenyl)piperazin-1-yl]ethyl]cyclohexyl]butanamide (PubChem CID 70956348) has the molecular formula C25H40N4O2 and a molecular weight of 428.62 g/mol. Its IUPAC name is 4-amino-N-[4-[2-[4-(3-propanoylphenyl)piperazin-1-yl]ethyl]cyclohexyl]butanamide.
| Compound Name | 4-amino-N-[4-[2-[4-(3-propanoylphenyl)piperazin-1-yl]ethyl]cyclohexyl]butanamide |
|---|---|
| PubChem CID | 70956348 |
| Molecular Formula | C25H40N4O2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 4-amino-N-[4-[2-[4-(3-propanoylphenyl)piperazin-1-yl]ethyl]cyclohexyl]butanamide |
| SMILES | CCC(=O)c1cccc(N2CCN(CCC3CCC(NC(=O)CCCN)CC3)CC2)c1 |
| InChI | InChI=1S/C25H40N4O2/c1-2-24(30)21-5-3-6-23(19-21)29-17-15-28(16-18-29)14-12-20-8-10-22(11-9-20)27-25(31)7-4-13-26/h3,5-6,19-20,22H,2,4,7-18,26H2,1H3,(H,27,31) |
| InChIKey | WFNYGPWXQBLUCR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |