C22H34FN3O3S — CID 174589477
3-fluoro-N-[4-[2-[4-(3-methylsulfonylphenyl)piperazin-1-yl]ethyl]cyclohexyl]propanamide (PubChem CID 174589477) has the molecular formula C22H34FN3O3S and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-fluoro-N-[4-[2-[4-(3-methylsulfonylphenyl)piperazin-1-yl]ethyl]cyclohexyl]propanamide.
| Compound Name | 3-fluoro-N-[4-[2-[4-(3-methylsulfonylphenyl)piperazin-1-yl]ethyl]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 174589477 |
| Molecular Formula | C22H34FN3O3S |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 3-fluoro-N-[4-[2-[4-(3-methylsulfonylphenyl)piperazin-1-yl]ethyl]cyclohexyl]propanamide |
| SMILES | CS(=O)(=O)c1cccc(N2CCN(CCC3CCC(NC(=O)CCF)CC3)CC2)c1 |
| InChI | InChI=1S/C22H34FN3O3S/c1-30(28,29)21-4-2-3-20(17-21)26-15-13-25(14-16-26)12-10-18-5-7-19(8-6-18)24-22(27)9-11-23/h2-4,17-19H,5-16H2,1H3,(H,24,27) |
| InChIKey | YRTVBAAZDRBUCS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |