C44H65N5O — CID 140543052
N,2-bis[4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]cyclopentene-1-carboxamide (PubChem CID 140543052) has the molecular formula C44H65N5O and a molecular weight of 680.04 g/mol. Its IUPAC name is N,2-bis[4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]cyclopentene-1-carboxamide.
| Compound Name | N,2-bis[4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]cyclopentene-1-carboxamide |
|---|---|
| PubChem CID | 140543052 |
| Molecular Formula | C44H65N5O |
| Molecular Weight | 680.04 g/mol |
| Exact Mass | 679.52 |
| IUPAC Name | N,2-bis[4-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]cyclohexyl]cyclopentene-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCC3CCC(NC(=O)C4=C(C5CCC(CCN6CCN(c7cccc(C)c7)CC6)CC5)CCC4)CC3)CC2)c1 |
| InChI | InChI=1S/C44H65N5O/c1-34-6-3-8-40(32-34)48-28-24-46(25-29-48)22-20-36-12-16-38(17-13-36)42-10-5-11-43(42)44(50)45-39-18-14-37(15-19-39)21-23-47-26-30-49(31-27-47)41-9-4-7-35(2)33-41/h3-4,6-9,32-33,36-39H,5,10-31H2,1-2H3,(H,45,50) |
| InChIKey | BGCUXQDQFSSISD-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.04 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |