C18H31Cl2N3 — CID 120663604
1-(3-methylphenyl)-4-(2-piperidin-4-ylethyl)piperazine;dihydrochloride (PubChem CID 120663604) has the molecular formula C18H31Cl2N3 and a molecular weight of 360.37 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-(2-piperidin-4-ylethyl)piperazine;dihydrochloride.
| Compound Name | 1-(3-methylphenyl)-4-(2-piperidin-4-ylethyl)piperazine;dihydrochloride |
|---|---|
| PubChem CID | 120663604 |
| Molecular Formula | C18H31Cl2N3 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-(3-methylphenyl)-4-(2-piperidin-4-ylethyl)piperazine;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCC3CCNCC3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C18H29N3.2ClH/c1-16-3-2-4-18(15-16)21-13-11-20(12-14-21)10-7-17-5-8-19-9-6-17;;/h2-4,15,17,19H,5-14H2,1H3;2*1H |
| InChIKey | PIZJVSQGMVHSRR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |