C16H25N3 — CID 22689612
1-(3-methylphenyl)-4-[[(2S)-pyrrolidin-2-yl]methyl]piperazine (PubChem CID 22689612) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-[[(2S)-pyrrolidin-2-yl]methyl]piperazine.
| Compound Name | 1-(3-methylphenyl)-4-[[(2S)-pyrrolidin-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 22689612 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-(3-methylphenyl)-4-[[(2S)-pyrrolidin-2-yl]methyl]piperazine |
| SMILES | Cc1cccc(N2CCN(C[C@@H]3CCCN3)CC2)c1 |
| InChI | InChI=1S/C16H25N3/c1-14-4-2-6-16(12-14)19-10-8-18(9-11-19)13-15-5-3-7-17-15/h2,4,6,12,15,17H,3,5,7-11,13H2,1H3/t15-/m0/s1 |
| InChIKey | PEJQJXYXVDRDDM-HNNXBMFYSA-N |
| XLogP | 1.87 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |