C15H21F3N4 — CID 164916943
1-[[(2S)-pyrrolidin-2-yl]methyl]-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 164916943) has the molecular formula C15H21F3N4 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-[[(2S)-pyrrolidin-2-yl]methyl]-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[[(2S)-pyrrolidin-2-yl]methyl]-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 164916943 |
| Molecular Formula | C15H21F3N4 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[[(2S)-pyrrolidin-2-yl]methyl]-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(C[C@@H]3CCCN3)CC2)n1 |
| InChI | InChI=1S/C15H21F3N4/c16-15(17,18)13-4-1-5-14(20-13)22-9-7-21(8-10-22)11-12-3-2-6-19-12/h1,4-5,12,19H,2-3,6-11H2/t12-/m0/s1 |
| InChIKey | IAQABHLKXULDMZ-LBPRGKRZSA-N |
| XLogP | 1.97 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |