C23H33ClF3N3O2 — CID 90323221
2-oxo-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanamide;hydrochloride (PubChem CID 90323221) has the molecular formula C23H33ClF3N3O2 and a molecular weight of 475.98 g/mol. Its IUPAC name is 2-oxo-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanamide;hydrochloride.
| Compound Name | 2-oxo-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 90323221 |
| Molecular Formula | C23H33ClF3N3O2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-oxo-N-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]cyclohexyl]butanamide;hydrochloride |
| SMILES | CCC(=O)C(=O)NC1CCC(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1.Cl |
| InChI | InChI=1S/C23H32F3N3O2.ClH/c1-2-21(30)22(31)27-19-8-6-17(7-9-19)10-11-28-12-14-29(15-13-28)20-5-3-4-18(16-20)23(24,25)26;/h3-5,16-17,19H,2,6-15H2,1H3,(H,27,31);1H |
| InChIKey | NZRADUXCRCXVNV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|