C28H35FN2O3S — CID 11294968
(E)-3-(3-fluorophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]prop-2-enamide (PubChem CID 11294968) has the molecular formula C28H35FN2O3S and a molecular weight of 498.66 g/mol. Its IUPAC name is (E)-3-(3-fluorophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluorophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 11294968 |
| Molecular Formula | C28H35FN2O3S |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (E)-3-(3-fluorophenyl)-N-[4-[2-(7-methylsulfonyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethyl]cyclohexyl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc2c(c1)CCN(CCC1CCC(NC(=O)/C=C/c3cccc(F)c3)CC1)CC2 |
| InChI | InChI=1S/C28H35FN2O3S/c1-35(33,34)27-11-8-23-14-17-31(18-15-24(23)20-27)16-13-21-5-9-26(10-6-21)30-28(32)12-7-22-3-2-4-25(29)19-22/h2-4,7-8,11-12,19-21,26H,5-6,9-10,13-18H2,1H3,(H,30,32)/b12-7+ |
| InChIKey | FBXKPSPDFUNMEE-KPKJPENVSA-N |
| XLogP | 4.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|